CAS 746651-90-1
:(4-fluoro-3-methyl-phenyl)-(3-fluorophenyl)methanone
Description:
(4-Fluoro-3-methyl-phenyl)-(3-fluorophenyl)methanone, with the CAS number 746651-90-1, is an organic compound characterized by its ketone functional group and the presence of fluorine and methyl substituents on aromatic rings. This compound features a central carbonyl group (C=O) bonded to two distinct phenyl groups, one of which has a methyl group and a fluorine atom at specific positions on the ring. The presence of fluorine atoms typically enhances the compound's lipophilicity and may influence its reactivity and biological activity. The molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where fluorinated compounds are often valued for their unique properties. Additionally, the compound's stability and solubility can be affected by the substituents on the aromatic rings, making it an interesting subject for further study in synthetic chemistry and material science. Overall, this compound exemplifies the diverse chemistry of fluorinated organic molecules.
Formula:C14H10F2O
InChI:InChI=1/C14H10F2O/c1-9-7-11(5-6-13(9)16)14(17)10-3-2-4-12(15)8-10/h2-8H,1H3
SMILES:Cc1cc(ccc1F)C(=O)c1cccc(c1)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.