CAS 746651-91-2
:(4-fluoro-2-methyl-phenyl)-(3-fluorophenyl)methanone
Description:
(4-fluoro-2-methyl-phenyl)-(3-fluorophenyl)methanone, with the CAS number 746651-91-2, is an organic compound characterized by its ketone functional group and the presence of fluorine substituents on aromatic rings. This compound features a central carbonyl group (C=O) bonded to two distinct phenyl groups, one of which has a methyl group and a fluorine atom in the para and ortho positions, respectively, while the other phenyl group has a fluorine atom in the meta position. The presence of fluorine atoms typically enhances the compound's lipophilicity and can influence its reactivity and biological activity. The molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where fluorinated compounds are often valued for their unique properties. Additionally, the compound may exhibit interesting physical properties such as solubility and melting point, which can be influenced by the arrangement of substituents and the overall molecular geometry. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C14H10F2O
InChI:InChI=1/C14H10F2O/c1-9-7-12(16)5-6-13(9)14(17)10-3-2-4-11(15)8-10/h2-8H,1H3
SMILES:Cc1cc(ccc1C(=O)c1cccc(c1)F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.