CAS 746651-92-3

(3-Fluorophenyl)(3,4,5-trifluorophenyl)methanone

Description:

(3-Fluorophenyl)(3,4,5-trifluorophenyl)methanone, identified by its CAS number 746651-92-3, is an organic compound characterized by the presence of two fluorinated phenyl groups attached to a central carbonyl (ketone) functional group. This compound features a methanone structure, where the carbonyl carbon is bonded to a (3-fluorophenyl) group and a (3,4,5-trifluorophenyl) group, indicating a high degree of fluorination. The presence of multiple fluorine atoms enhances the compound's lipophilicity and may influence its reactivity and stability, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The fluorine substituents can also affect the electronic properties of the molecule, potentially altering its interaction with biological targets. Additionally, the compound's solid-state properties, such as melting point and solubility, would be influenced by the steric and electronic effects of the fluorine atoms. Overall, this compound exemplifies the significance of fluorinated organic molecules in modern chemistry, particularly in the development of new materials and therapeutic agents.

Formula: C₁₃H₆F₄O

InChI: InChI=1S/C13H6F4O/c14-9-3-1-2-7(4-9)13(18)8-5-10(15)12(17)11(16)6-8/h1-6H

InChI key: InChIKey=HOUGDIGMWHMSBC-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(F)=C(F)C(F)=C1)C2=CC(F)=CC=C2

Synonyms:

• Methanone, (3-fluorophenyl)(3,4,5-trifluorophenyl)-
• (3-Fluorophenyl)(3,4,5-trifluorophenyl)methanone