CAS 746651-93-4

(2-Fluorophenyl)(3,4,5-trifluorophenyl)methanone

Description:

(2-Fluorophenyl)(3,4,5-trifluorophenyl)methanone, with the CAS number 746651-93-4, is an organic compound characterized by its complex fluorinated aromatic structure. This compound features a ketone functional group, which is indicated by the presence of the methanone moiety, and is substituted with two distinct phenyl groups: one containing a fluorine atom at the 2-position and the other bearing three fluorine atoms at the 3, 4, and 5 positions. The presence of multiple fluorine atoms enhances the compound's lipophilicity and may influence its reactivity and stability. Such fluorinated compounds are often of interest in medicinal chemistry and materials science due to their unique electronic properties and potential biological activity. The compound is likely to be a solid at room temperature, exhibiting moderate solubility in organic solvents. Its synthesis typically involves the introduction of fluorine substituents onto aromatic rings, followed by the formation of the ketone linkage. Safety data should be consulted for handling, as fluorinated compounds can exhibit specific hazards.

Formula: C₁₃H₆F₄O

InChI: InChI=1S/C13H6F4O/c14-9-4-2-1-3-8(9)13(18)7-5-10(15)12(17)11(16)6-7/h1-6H

InChI key: InChIKey=YOUYYOAGQZUCJD-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(F)=C(F)C(F)=C1)C2=C(F)C=CC=C2

Synonyms:

• (2-Fluorophenyl)(3,4,5-trifluorophenyl)methanone
• Methanone, (2-fluorophenyl)(3,4,5-trifluorophenyl)-