CAS 746651-94-5
:(2-chlorophenyl)-(3,4,5-trifluorophenyl)methanone
Description:
(2-chlorophenyl)-(3,4,5-trifluorophenyl)methanone, with the CAS number 746651-94-5, is an organic compound characterized by its complex aromatic structure. It features a ketone functional group, which is indicated by the presence of the methanone moiety. The compound contains two distinct phenyl rings: one substituted with a chlorine atom at the second position and the other with three fluorine atoms at the 3, 4, and 5 positions. This substitution pattern significantly influences its chemical properties, including its reactivity and polarity. The presence of electronegative halogens, such as chlorine and fluorine, enhances the compound's electron-withdrawing characteristics, which can affect its behavior in various chemical reactions, including nucleophilic attacks. Additionally, the compound may exhibit interesting biological activities, making it of interest in pharmaceutical research. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific interactions between its functional groups and the surrounding environment. Overall, this compound exemplifies the complexity and diversity of organic chemistry.
Formula:C13H6ClF3O
InChI:InChI=1/C13H6ClF3O/c14-9-4-2-1-3-8(9)13(18)7-5-10(15)12(17)11(16)6-7/h1-6H
SMILES:c1ccc(c(c1)C(=O)c1cc(c(c(c1)F)F)F)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.