CAS 746651-95-6
:(3-chlorophenyl)(3,4,5-trifluorophenyl)methanone
Description:
(3-chlorophenyl)(3,4,5-trifluorophenyl)methanone, with the CAS number 746651-95-6, is an organic compound characterized by its complex aromatic structure. It features a ketone functional group, indicated by the presence of the methanone moiety, which is attached to two distinct phenyl groups. One of these groups is a chlorinated phenyl, while the other is a trifluorinated phenyl, contributing to the compound's unique electronic and steric properties. The presence of multiple halogen atoms, particularly fluorine, enhances the compound's lipophilicity and may influence its reactivity and interaction with biological systems. This compound is likely to exhibit significant stability due to the resonance stabilization provided by the aromatic rings. Its potential applications may span across pharmaceuticals, agrochemicals, or materials science, where such halogenated compounds are often explored for their unique properties. Safety and handling considerations are essential, given the presence of halogens, which can pose environmental and health risks.
Formula:C13H6ClF3O
InChI:InChI=1/C13H6ClF3O/c14-9-3-1-2-7(4-9)13(18)8-5-10(15)12(17)11(16)6-8/h1-6H
SMILES:c1cc(cc(c1)Cl)C(=O)c1cc(c(c(c1)F)F)F
Synonyms:- Methanone, (3-chlorophenyl)(3,4,5-trifluorophenyl)-
- (3-Chlorophenyl)(3,4,5-trifluorophenyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.