CAS 746651-96-7

(4-Chlorophenyl)(3,4,5-trifluorophenyl)methanone

Description:

(4-Chlorophenyl)(3,4,5-trifluorophenyl)methanone, with the CAS number 746651-96-7, is an organic compound characterized by its complex aromatic structure. It features a ketone functional group, which is indicated by the presence of the methanone moiety, and is substituted with a 4-chlorophenyl group and a 3,4,5-trifluorophenyl group. The presence of multiple fluorine atoms contributes to its unique chemical properties, such as increased lipophilicity and potential biological activity. This compound is likely to exhibit significant stability due to the strong C-F bonds, which can influence its reactivity and interactions with other molecules. Additionally, the chlorinated and fluorinated aromatic rings may enhance its potential as a pharmaceutical intermediate or in agrochemical applications. Its synthesis and handling require careful consideration of safety protocols due to the presence of halogenated compounds, which can pose environmental and health risks. Overall, this compound represents a class of halogenated aromatic ketones with potential applications in various fields of chemistry and materials science.

Formula: C₁₃H₆ClF₃O

InChI: InChI=1/C13H6ClF3O/c14-9-3-1-7(2-4-9)13(18)8-5-10(15)12(17)11(16)6-8/h1-6H

InChI key: InChIKey=HSAXKZYYPDQFHA-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(F)=C(F)C(F)=C1)C2=CC=C(Cl)C=C2

Synonyms:

• Methanone, (4-chlorophenyl)(3,4,5-trifluorophenyl)-
• (4-Chlorophenyl)(3,4,5-trifluorophenyl)methanone
• 4-CHLORO-3',4',5'-TRIFLUOROBENZOPHENONE
• 4-Chloro-3′,4′,5′-trifluorobenzophenone, CAS 746651-96-7