CAS 746651-97-8

(2-Chlorophenyl)(3,5-difluorophenyl)methanone

Description:

(2-Chlorophenyl)(3,5-difluorophenyl)methanone, identified by its CAS number 746651-97-8, is an organic compound characterized by the presence of a ketone functional group attached to two aromatic rings. The structure features a chlorinated phenyl group at the 2-position and a difluorinated phenyl group at the 3 and 5 positions, contributing to its unique chemical properties. This compound is typically a solid at room temperature and exhibits moderate solubility in organic solvents due to its non-polar aromatic nature. The presence of halogen substituents can influence its reactivity, making it a potential candidate for various chemical reactions, including electrophilic aromatic substitution. Additionally, the compound may exhibit biological activity, which can be explored in pharmaceutical applications. Its specific melting point, boiling point, and other physical properties would depend on the purity and specific conditions under which it is measured. Overall, (2-Chlorophenyl)(3,5-difluorophenyl)methanone is of interest in both synthetic organic chemistry and medicinal chemistry research.

Formula: C₁₃H₇ClF₂O

InChI: InChI=1/C13H7ClF2O/c14-12-4-2-1-3-11(12)13(17)8-5-9(15)7-10(16)6-8/h1-7H

InChI key: InChIKey=WGJBQJLWYGAYNE-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(Cl)C=CC=C1)C2=CC(F)=CC(F)=C2

Synonyms:

• Methanone, (2-Chlorophenyl)(3,5-Difluorophenyl)-
• (2-Chlorophenyl)(3,5-difluorophenyl)methanone