CymitQuimica logo

CAS 746652-01-7

:

ethyl 3-[(2-methoxyphenyl)carbonyl]benzoate

Description:
Ethyl 3-[(2-methoxyphenyl)carbonyl]benzoate, identified by its CAS number 746652-01-7, is an organic compound characterized by its ester functional group and aromatic structure. This compound features a benzoate moiety, which is a derivative of benzoic acid, and is further substituted with a 2-methoxyphenyl group, enhancing its aromatic character. The presence of the ethyl group contributes to its solubility in organic solvents, making it suitable for various applications in organic synthesis and pharmaceuticals. Ethyl 3-[(2-methoxyphenyl)carbonyl]benzoate may exhibit properties such as moderate to high melting and boiling points, depending on its molecular interactions and purity. Additionally, it may possess biological activity, which could be explored in medicinal chemistry. Its synthesis typically involves acylation reactions, and it may be used as an intermediate in the production of more complex organic molecules. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C17H16O4
InChI:InChI=1/C17H16O4/c1-3-21-17(19)13-8-6-7-12(11-13)16(18)14-9-4-5-10-15(14)20-2/h4-11H,3H2,1-2H3
SMILES:CCOC(=O)c1cccc(c1)C(=O)c1ccccc1OC
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.