CAS 746652-02-8
:Ethyl 4-(2-methoxybenzoyl)benzoate
Description:
Ethyl 4-(2-methoxybenzoyl)benzoate, with the CAS number 746652-02-8, is an organic compound characterized by its ester functional group, which is derived from the reaction of benzoic acid and ethanol. This compound features a benzoyl moiety substituted with a methoxy group at the ortho position, contributing to its unique chemical properties. It typically appears as a solid or liquid, depending on the specific conditions, and is known for its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The presence of the methoxy group enhances its solubility in organic solvents and may influence its reactivity and stability. Ethyl 4-(2-methoxybenzoyl)benzoate may also exhibit interesting photochemical properties, making it a candidate for studies in photochemistry and materials science. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C17H16O4
InChI:InChI=1S/C17H16O4/c1-3-21-17(19)13-10-8-12(9-11-13)16(18)14-6-4-5-7-15(14)20-2/h4-11H,3H2,1-2H3
InChI key:InChIKey=KYHZXOYDILTTPA-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(OC)C=CC=C1)C2=CC=C(C(OCC)=O)C=C2
Synonyms:- Benzoic acid, 4-(2-methoxybenzoyl)-, ethyl ester
- Ethyl 4-(2-methoxybenzoyl)benzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.