CAS 746652-03-9

(2-Methoxyphenyl)[2-(methylthio)phenyl]methanone

Description:

(2-Methoxyphenyl)[2-(methylthio)phenyl]methanone, with the CAS number 746652-03-9, is an organic compound characterized by its complex structure, which includes a methoxy group and a methylthio group attached to phenyl rings. This compound typically exhibits properties common to ketones, such as being a polar substance due to the presence of the carbonyl group, which can engage in hydrogen bonding. The methoxy group enhances its solubility in organic solvents, while the methylthio group may influence its reactivity and interaction with biological systems. The compound may also display interesting optical properties due to the arrangement of its aromatic rings, potentially making it useful in various applications, including pharmaceuticals and materials science. Its synthesis and reactivity can be influenced by the substituents on the phenyl rings, which can affect electronic distribution and steric hindrance. Overall, this compound's unique structural features contribute to its potential utility in chemical research and development.

Formula: C₁₅H₁₄O₂S

InChI: InChI=1S/C15H14O2S/c1-17-13-9-5-3-7-11(13)15(16)12-8-4-6-10-14(12)18-2/h3-10H,1-2H3

InChI key: InChIKey=VCCSYWOOWUVEDJ-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(OC)C=CC=C1)C2=C(SC)C=CC=C2

Synonyms:

• (2-Methoxyphenyl)[2-(methylthio)phenyl]methanone
• (2-Methoxyphenyl)-(2-methylsulfanylphenyl)methanone
• Methanone, (2-methoxyphenyl)[2-(methylthio)phenyl]-

2-Methoxy-2′-thiomethylbenzophenone

CAS: 746652-03-9

Formula: C₁₅H₁₄O₂S

Purity: 97.0%

Molecular weight: 258.34

Ref: 10-F201513