CymitQuimica logo

CAS 746668-75-7

:

2-(4-Iodo-1H-pyrazol-3-yl)pyridine

Description:
2-(4-Iodo-1H-pyrazol-3-yl)pyridine is a chemical compound characterized by its unique structure, which includes a pyridine ring and a pyrazole moiety. The presence of the iodine atom at the 4-position of the pyrazole contributes to its reactivity and potential applications in medicinal chemistry and material science. This compound typically exhibits properties such as moderate solubility in organic solvents and may show varying degrees of stability depending on environmental conditions. Its molecular structure allows for potential interactions with biological targets, making it of interest in drug discovery. Additionally, the compound may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, due to the presence of the halogen atom. Overall, 2-(4-Iodo-1H-pyrazol-3-yl)pyridine is a versatile compound with potential applications in various fields, including pharmaceuticals and agrochemicals, owing to its distinctive chemical properties and structural features.
Formula:C8H6IN3
InChI:InChI=1S/C8H6IN3/c9-6-5-11-12-8(6)7-3-1-2-4-10-7/h1-5H,(H,11,12)
InChI key:InChIKey=VULGPJXBNXWECZ-UHFFFAOYSA-N
SMILES:IC=1C(=NNC1)C2=CC=CC=N2
Synonyms:
  • 2-(4-iodo-1H-pyrazol-3-yl)pyridine
  • Pyridine, 2-(4-iodo-1H-pyrazol-3-yl)-
  • 2-(4-Iodo-1H-pyrazol-3-yl)pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.