CAS 746671-61-4

4,6-Dichloropyrido[2,3-d]pyrimidine

Description:

4,6-Dichloropyrido[2,3-d]pyrimidine is a heterocyclic compound characterized by its fused pyridine and pyrimidine rings, which incorporate two chlorine substituents at the 4 and 6 positions. This compound typically exhibits a pale yellow to off-white crystalline appearance. It is known for its potential applications in medicinal chemistry, particularly as a building block in the synthesis of various pharmaceuticals and agrochemicals. The presence of chlorine atoms enhances its reactivity and may influence its biological activity. The compound is generally soluble in organic solvents, but its solubility in water is limited. Its molecular structure contributes to its unique electronic properties, making it a subject of interest in research related to drug design and development. Safety data sheets indicate that it should be handled with care, as it may pose health risks upon exposure. Overall, 4,6-Dichloropyrido[2,3-d]pyrimidine is a significant compound in the field of organic chemistry with various potential applications.

Formula: C₇H₃Cl₂N₃

InChI: InChI=1S/C7H3Cl2N3/c8-4-1-5-6(9)11-3-12-7(5)10-2-4/h1-3H

InChI key: InChIKey=UIWQZHNOVPDFTA-UHFFFAOYSA-N

SMILES: ClC=1C2=C(N=CC(Cl)=C2)N=CN1

Synonyms:

• 4,6-Dichloropyrido[2,3-d]pyrimidine
• Pyrido[2,3-d]pyrimidine, 4,6-dichloro-