CAS 74668-74-9

2-Chloro-8-methoxyquinoline

Description:

2-Chloro-8-methoxyquinoline is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a chlorine atom at the second position and a methoxy group at the eighth position contributes to its unique chemical properties. This compound typically appears as a solid and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. It may exhibit antimicrobial, antiviral, or anticancer properties, making it of interest in drug discovery. The molecular structure influences its solubility, reactivity, and interaction with biological targets. Additionally, 2-chloro-8-methoxyquinoline can undergo various chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions, depending on the conditions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, this compound represents a significant area of study within organic and medicinal chemistry.

Formula: C₁₀H₈ClNO

InChI: InChI=1/C10H8ClNO/c1-13-8-4-2-3-7-5-6-9(11)12-10(7)8/h2-6H,1H3

SMILES: COc1cccc2ccc(Cl)nc12

Quinoline,2-chloro-8-methoxy-

CAS: 74668-74-9

Formula: C₁₀H₈ClNO

Purity: 98%

Color and Shape: Solid

Molecular weight: 193.6296

Ref: IN-DA005IHG

2-Chloro-8-methoxyquinoline

CAS: 74668-74-9

2-Chloro-8-methoxyquinoline

Purity: 98%

Molecular weight: 193.63g/mol

Ref: 54-OR77096

2-chloro-8-methoxyquinoline

CAS: 74668-74-9

Formula: C₁₀H₈ClNO

Purity: 98%

Color and Shape: Solid

Molecular weight: 193.63

Ref: 10-F313792