CAS 7467-35-8

(1-methyl-1H-benzimidazol-2-yl)methanol

Description:

(1-methyl-1H-benzimidazol-2-yl)methanol, with the CAS number 7467-35-8, is an organic compound characterized by its benzimidazole structure, which consists of a fused benzene and imidazole ring. This compound features a methyl group at the 1-position of the benzimidazole ring and a hydroxymethyl group (-CH2OH) at the 2-position, contributing to its unique chemical properties. It is typically a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the presence of the hydroxymethyl group. The compound may exhibit biological activity, making it of interest in pharmaceutical research. Its structure allows for potential interactions with biological targets, which can be explored for therapeutic applications. Additionally, the presence of both aromatic and aliphatic functional groups may influence its reactivity and stability under various conditions. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.

Formula: C₉H₁₀N₂O

InChI: InChI=1/C9H10N2O/c1-11-8-5-3-2-4-7(8)10-9(11)6-12/h2-5,12H,6H2,1H3

SMILES: Cn1c2ccccc2nc1CO

Synonyms:

• 1H-benzimidazole-2-methanol, 1-methyl-

(1-Methyl-1H-benzoimidazol-2-yl)-methanol

CAS: 7467-35-8

Formula: C₉H₁₀N₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 162.1885

Ref: IN-DA005A6G

(1-Methyl-1H-benzoimidazol-2-yl)methanol

CAS: 7467-35-8

(1-Methyl-1H-benzoimidazol-2-yl)methanol

Purity: 97%

Molecular weight: 162.19g/mol

Ref: 54-OR346407

(1-methyl-1H-benzimidazol-2-yl)methanol

CAS: 7467-35-8

Formula: C₉H₁₀N₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 162.192

Ref: 10-F313789

(1-Methyl-1H-benzimidazol-2-yl)methanol

Controlled Product

CAS: 7467-35-8

1-Methyl-1H-benzimidazol-2-yl)methanol is a mononuclear, ligand anion with a sulfate group. The compound has a molecular weight of 180.07 and its chemical formula is C6H5NOSO3S. It is soluble in water and alcohols, but insoluble in ethers and chloroform. 1-Methyl-1H-benzimidazol-2-yl)methanol reacts with oxygen to form the corresponding peroxide, which has a boiling point of 228°C at 760 mm Hg pressure. This compound also reacts with nitric acid to form the corresponding nitrate salt, which can be precipitated by adding sodium chloride or ammonium chloride.

Formula: C₉H₁₀N₂O

Purity: Min. 95%

Molecular weight: 162.19 g/mol

Ref: 3D-FM117093