CAS 7467-48-3
:4-amino-N-cyclohexyl-N-methylbenzenesulfonamide
Description:
4-Amino-N-cyclohexyl-N-methylbenzenesulfonamide, with the CAS number 7467-48-3, is a chemical compound that belongs to the class of sulfonamides. This substance features a sulfonamide functional group, which is characterized by the presence of a sulfonyl (SO2) moiety attached to an amine. The compound has a cyclohexyl group and a methyl group attached to the nitrogen atoms, contributing to its unique properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the sulfonamide group. The compound is of interest in various fields, including medicinal chemistry, where sulfonamides are often explored for their antibacterial properties. Additionally, its structural characteristics may influence its biological activity and interactions with other molecules. Safety data should be consulted for handling and usage, as with all chemical substances, to ensure proper precautions are taken.
Formula:C13H20N2O2S
InChI:InChI=1/C13H20N2O2S/c1-15(12-5-3-2-4-6-12)18(16,17)13-9-7-11(14)8-10-13/h7-10,12H,2-6,14H2,1H3
SMILES:CN(C1CCCCC1)S(=O)(=O)c1ccc(cc1)N
Synonyms:- Benzenesulfonamide, 4-amino-N-cyclohexyl-N-methyl-
- 4-Amino-N-cyclohexyl-N-methylbenzenesulfonamide
- 4-amino-N-cyclohexyl-N-methylbenzene-1-sulfonamide
- 4-AMINO-N-CYCLOHEXYL-N-METHYL-BENZENESULFONAMIDE
- AKOS BBB/036
- TIMTEC-BB SBB001051
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Amino-N-cyclohexyl-N-methyl-benzenesulfonamide
CAS:Formula:C13H20N2O2SColor and Shape:SolidMolecular weight:268.3751
