CAS 7467-91-6
:quinoxalin-6(4H)-one
Description:
Quinoxalin-6(4H)-one, with the CAS number 7467-91-6, is a heterocyclic organic compound that belongs to the class of quinoxalines. It features a bicyclic structure composed of a quinoxaline ring fused with a carbonyl group, specifically at the 6-position. This compound is characterized by its aromatic nature, which contributes to its stability and reactivity. Quinoxalin-6(4H)-one is typically a solid at room temperature and is soluble in various organic solvents. It exhibits biological activity, making it of interest in medicinal chemistry, particularly for its potential as an antimicrobial or anticancer agent. The presence of the carbonyl group enhances its reactivity, allowing for various chemical modifications. Additionally, quinoxalin-6(4H)-one can participate in diverse chemical reactions, including nucleophilic substitutions and cycloadditions, which are valuable in synthetic organic chemistry. Its derivatives are often explored for their pharmacological properties, contributing to ongoing research in drug development and therapeutic applications.
Formula:C8H6N2O
InChI:InChI=1/C8H6N2O/c11-6-1-2-7-8(5-6)10-4-3-9-7/h1-5,10H
SMILES:c1cc2c(cc1=O)[nH]ccn2
Synonyms:- 6-Hydroxyquinoxaline
- 4H-quinoxalin-6-one
- 6-Quinoxalinol
- quinoxalin-6-ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
6-Quinoxalinol
CAS:Formula:C8H6N2OPurity:>98.0%(GC)(T)Color and Shape:Yellow to Brown to Dark green powder to crystalMolecular weight:146.15Quinoxalin-6-ol
CAS:<p>Quinoxalin-6-ol is an antibacterial agent that has shown to be effective against gram-negative bacteria such as Escherichia coli, Salmonella enteritidis, and Pseudomonas aeruginosa. It also has antifungal activity against Candida albicans and Saccharomyces cerevisiae. Quinoxalin-6-ol is a quinone that can be synthesized from crotonic acid or ethyl acetoacetate. This compound can be found in the form of two isomers (E and Z) which are distinguished by their physical properties.</p>Formula:C8H6N2OPurity:Min. 95%Molecular weight:146.15 g/mol
