CAS 74681-63-3
:Methacryloxymethyltris(trimethylsiloxy)silane
Description:
Methacryloxymethyltris(trimethylsiloxy)silane, with the CAS number 74681-63-3, is a silane compound characterized by its unique structure that combines methacryloxy and siloxane functionalities. This compound typically appears as a colorless to pale yellow liquid and is known for its reactivity, particularly in polymerization processes. The presence of the methacryloxy group allows it to participate in free radical polymerization, making it useful as a coupling agent or modifier in various applications, including adhesives, coatings, and sealants. The trimethylsiloxy groups contribute to its hydrophobic properties and enhance its compatibility with silicone-based materials. Additionally, this silane exhibits good thermal stability and resistance to moisture, which is advantageous in applications requiring durability. Its ability to bond with both organic and inorganic substrates makes it valuable in enhancing the performance of composite materials. Overall, Methacryloxymethyltris(trimethylsiloxy)silane is a versatile compound with significant utility in materials science and engineering.
Formula:C14H34O5Si4
InChI:InChI=1/C14H34O5Si4/c1-13(2)14(15)16-12-23(17-20(3,4)5,18-21(6,7)8)19-22(9,10)11/h1,12H2,2-11H3
SMILES:C=C(C)C(=O)OC[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C
Synonyms:- {1,1,1,5,5,5-Hexamethyl-3-[(Trimethylsilyl)Oxy]Trisiloxan-3-Yl}Methyl 2-Methylprop-2-Enoate
- 3-Methacryloxymethyltris(trimethylsiloxy)silane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Methacryloxymethyltris(trimethylsiloxy)silane
CAS:S10523 - Methacryloxymethyltris(trimethylsiloxy)silane
Formula:C14H34O5Si4Color and Shape:LiquidMolecular weight:394.761
