CAS 74682-60-3
:5-(Hexylthio)-1H-1,2,4-triazole
Description:
5-(Hexylthio)-1H-1,2,4-triazole is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features a hexylthio group, which contributes to its hydrophobic properties and influences its solubility and interaction with biological systems. The presence of the triazole moiety often imparts significant biological activity, making such compounds of interest in agricultural and pharmaceutical applications, particularly as fungicides or in the development of agrochemicals. The molecular structure allows for potential interactions with various biological targets, which can lead to diverse effects depending on the specific context of use. Additionally, the compound's stability, reactivity, and potential for forming complexes with metal ions can be influenced by the substituents on the triazole ring. Overall, 5-(Hexylthio)-1H-1,2,4-triazole exemplifies the importance of structural features in determining the chemical behavior and application of triazole derivatives in various fields.
Formula:C8H15N3S
InChI:InChI=1S/C8H15N3S/c1-2-3-4-5-6-12-8-9-7-10-11-8/h7H,2-6H2,1H3,(H,9,10,11)
InChI key:InChIKey=NZXRSXPNMMTVHB-UHFFFAOYSA-N
SMILES:S(CCCCCC)C=1NC=NN1
Synonyms:- 1H-1,2,4-Triazole, 3-(hexylthio)-
- 1H-1,2,4-Triazole, 5-(hexylthio)-
- 3-(Hexylsulfanyl)-4H-1,2,4-triazole
- 3-(Hexylthio)-1H-1,2,4-triazole
- 3-Hexylthio-1,2,4-triazole
- 3-n-Hexylthio-1,2,4-triazole
- 5-(Hexylthio)-1H-1,2,4-triazole
- 5-(hexylsulfanyl)-1H-1,2,4-triazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
