CAS 74683-11-7
:4-Nerolidylcatechol
Description:
4-Nerolidylcatechol is a chemical compound characterized by its unique structure, which includes a catechol moiety and a nerolidyl group. This compound is part of the larger family of phenolic compounds, known for their diverse biological activities. It typically exhibits antioxidant properties, which can be attributed to the presence of the catechol structure, allowing it to scavenge free radicals. Additionally, 4-Nerolidylcatechol may possess antimicrobial and anti-inflammatory effects, making it of interest in various fields, including pharmaceuticals and cosmetics. The compound's solubility and stability can vary depending on the solvent and environmental conditions, influencing its potential applications. As with many organic compounds, its reactivity can be influenced by factors such as pH and temperature. Overall, 4-Nerolidylcatechol represents a fascinating area of study due to its potential health benefits and applications in natural product chemistry.
Formula:C21H30O2
InChI:InChI=1S/C21H30O2/c1-6-21(5,18-12-13-19(22)20(23)15-18)14-8-11-17(4)10-7-9-16(2)3/h6,9,11-13,15,22-23H,1,7-8,10,14H2,2-5H3
InChI key:InChIKey=ZBZZDHDWRSFLAY-UHFFFAOYSA-N
SMILES:C(CCC=C(CCC=C(C)C)C)(C=C)(C)C1=CC(O)=C(O)C=C1
Synonyms:- 1,2-Benzenediol, 4-(1-ethenyl-1,5,9-trimethyl-4,8-decadien-1-yl)-
- 1,2-Benzenediol, 4-(1-ethenyl-1,5,9-trimethyl-4,8-decadienyl)-
- 4-(1-Ethenyl-1,5,9-trimethyl-4,8-decadien-1-yl)-1,2-benzenediol
- 4-Nerolidylcatechol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
