CAS 74683-16-2
:Nectandrin B
Description:
Nectandrin B is a chemical compound classified as a natural product, specifically a type of alkaloid. It is derived from various plant sources, particularly those belonging to the genus Nectandra. The compound is characterized by its complex molecular structure, which includes multiple rings and functional groups that contribute to its biological activity. Nectandrin B has garnered interest in the field of medicinal chemistry due to its potential pharmacological properties, including anti-inflammatory and antimicrobial effects. Its mechanism of action and specific interactions within biological systems are subjects of ongoing research. The compound is typically studied in the context of its therapeutic potential, and its safety profile is evaluated through various toxicological assessments. As with many natural products, the extraction and purification processes can influence the yield and purity of Nectandrin B, making it essential for researchers to employ precise methodologies in their studies. Overall, Nectandrin B represents a fascinating area of study within the realm of natural product chemistry and its applications in medicine.
Formula:C20H24O5
InChI:InChI=1/C20H24O5/c1-11-12(2)20(14-6-8-16(22)18(10-14)24-4)25-19(11)13-5-7-15(21)17(9-13)23-3/h5-12,19-22H,1-4H3/t11-,12+,19-,20+
InChI key:InChIKey=GMXMKSFJQLFOSO-JARDSOJUNA-N
SMILES:C[C@@H]1[C@H](O[C@H]([C@@H]1C)C2=CC(OC)=C(O)C=C2)C3=CC(OC)=C(O)C=C3
Synonyms:- Calophyllin
- Malabaricanol
- Nectandrin B
- Phenol, 4,4′-(tetrahydro-3,4-dimethyl-2,5-furandiyl)bis[2-methoxy-, (2α,3β,4β,5α)-
- Phenol, 4,4′-[(2R,3R,4S,5S)-tetrahydro-3,4-dimethyl-2,5-furandiyl]bis[2-methoxy-, rel-
- phenol, 4,4'-[(2R,3R,4S,5S)-tetrahydro-3,4-dimethyl-2,5-furandiyl]bis[2-methoxy-
- rel-(8S,8′R)-Dimethyl-(7S,7′R)-bis(4-hydroxy-3-methoxyphenyl)tetrahydrofuran
- rel-4,4′-[(2R,3R,4S,5S)-Tetrahydro-3,4-dimethyl-2,5-furandiyl]bis[2-methoxyphenol]
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Nectandrin B
CAS:Nectandrin B is an isoflavonoid, a type of natural product, which is derived from the leaves of certain plants, particularly those in the Lauraceae family. It exhibits its biological effects primarily through its antioxidant and anti-inflammatory properties, which involve the scavenging of free radicals and the modulation of specific signaling pathways associated with inflammatory responses.
Formula:C20H24O5Purity:Min. 95%Molecular weight:344.4 g/mol

