CAS 74693-62-2

1-ethyl-2-hydroxy-4-oxo-1,4-dihydroquinoline-3-carbohydrazide

Description:

1-Ethyl-2-hydroxy-4-oxo-1,4-dihydroquinoline-3-carbohydrazide, with CAS number 74693-62-2, is a chemical compound that belongs to the class of quinoline derivatives. This substance typically exhibits a complex structure characterized by a quinoline ring system, which is known for its diverse biological activities. The presence of a hydroxy group and a carbohydrazide moiety contributes to its potential reactivity and solubility in various solvents. It may display properties such as antimicrobial, anti-inflammatory, or antioxidant activities, making it of interest in pharmaceutical research. The compound's molecular structure suggests it could participate in hydrogen bonding and other intermolecular interactions, influencing its behavior in biological systems. Additionally, its stability and reactivity can be affected by environmental factors such as pH and temperature. Overall, 1-ethyl-2-hydroxy-4-oxo-1,4-dihydroquinoline-3-carbohydrazide represents a unique chemical entity with potential applications in medicinal chemistry and related fields.

Formula: C₁₂H₁₃N₃O₃

InChI: InChI=1/C12H13N3O3/c1-2-15-8-6-4-3-5-7(8)10(16)9(12(15)18)11(17)14-13/h3-6,18H,2,13H2,1H3,(H,14,17)

SMILES: CCn1c2ccccc2c(=O)c(C(=NN)O)c1O