
CAS 74697-69-1
:4-(3-Aminobutyl)benzonitrile
Description:
4-(3-Aminobutyl)benzonitrile, identified by its CAS number 74697-69-1, is an organic compound characterized by the presence of a benzonitrile moiety substituted with a 3-aminobutyl group. This compound features a benzene ring attached to a nitrile group (–C≡N) and a side chain containing an amine functional group. The presence of the amino group suggests that it can participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it a potential candidate for applications in pharmaceuticals or organic synthesis. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the amino group. Its molecular structure allows for potential interactions with biological systems, which could be explored for medicinal chemistry applications. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C11H14N2
InChI:InChI=1S/C11H14N2/c1-9(13)2-3-10-4-6-11(8-12)7-5-10/h4-7,9H,2-3,13H2,1H3
InChI key:InChIKey=DSXBESAQISJNCZ-UHFFFAOYSA-N
SMILES:C(CC(C)N)C1=CC=C(C#N)C=C1
Synonyms:- 4-(3-Aminobutyl)benzonitrile
- 1-Methyl-3-(4-cyanophenyl)propylamine
- Benzonitrile, 4-(3-aminobutyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.