CAS 7470-75-9

3-amino-N-(pyrimidin-2-yl)benzenesulfonamide

Description:

3-Amino-N-(pyrimidin-2-yl)benzenesulfonamide, with the CAS number 7470-75-9, is a chemical compound that features a sulfonamide functional group, which is characterized by the presence of a sulfonyl group (–SO2) attached to an amine. This compound contains an amino group (–NH2) and a pyrimidine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of the pyrimidine moiety contributes to its potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The sulfonamide group is known for its antibacterial properties, and compounds like this one may exhibit similar effects. In terms of solubility, sulfonamides generally have moderate solubility in water, influenced by the presence of polar functional groups. The compound's structure suggests it may participate in hydrogen bonding, which can affect its interactions in biological systems. Overall, 3-amino-N-(pyrimidin-2-yl)benzenesulfonamide is a compound of interest for its potential applications in drug development and its unique chemical properties.

Formula: C₁₀H₁₀N₄O₂S

InChI: InChI=1/C10H10N4O2S/c11-8-3-1-4-9(7-8)17(15,16)14-10-12-5-2-6-13-10/h1-7H,11H2,(H,12,13,14)

SMILES: c1cc(cc(c1)S(=O)(=O)Nc1ncccn1)N

3-Amino-N-(pyrimidin-2-yl)benzene-1-sulfonamide

CAS: 7470-75-9

Versatile small molecule scaffold

Formula: C₁₀H₁₀N₄O₂S

Purity: Min. 95%

Molecular weight: 250.28 g/mol

Ref: 3D-HAA47075