CAS 74701-47-6
:2-Ethyl-6-isopropylpyridine
Description:
2-Ethyl-6-isopropylpyridine is an organic compound belonging to the class of pyridines, which are aromatic heterocyclic compounds containing a nitrogen atom in the ring. This particular compound features a pyridine ring substituted with an ethyl group at the 2-position and an isopropyl group at the 6-position, contributing to its unique structural characteristics. It is typically a colorless to pale yellow liquid with a distinctive odor. The presence of the nitrogen atom in the pyridine ring imparts basic properties, allowing it to participate in various chemical reactions, such as nucleophilic substitutions. Its solubility in organic solvents and limited solubility in water make it useful in various applications, including as a solvent, intermediate in organic synthesis, or in the formulation of agrochemicals and pharmaceuticals. Additionally, its molecular structure can influence its reactivity and interactions with other chemical species, making it a subject of interest in both industrial and research settings. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C10H15N
InChI:InChI=1/C10H15N/c1-4-9-6-5-7-10(11-9)8(2)3/h5-8H,4H2,1-3H3
SMILES:CCc1cccc(C(C)C)n1
Synonyms:- 2-Ethyl-6-isopropyl pyridine
- 2-Ethyl-6-(Propan-2-Yl)Pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

