
CAS 74702-91-3
:2,6-Dichloro-α,α-dimethylbenzenemethanamine
Description:
2,6-Dichloro-α,α-dimethylbenzenemethanamine, also known by its CAS number 74702-91-3, is an organic compound characterized by its structure, which includes a benzene ring substituted with two chlorine atoms and an amine group. This compound features a dimethyl group at the alpha position relative to the amine, contributing to its steric properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of chlorine atoms enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the amine functional group can participate in hydrogen bonding, influencing its physical properties and potential applications. Safety data indicates that it should be handled with care due to potential toxicity and environmental impact. Overall, 2,6-Dichloro-α,α-dimethylbenzenemethanamine is of interest in chemical research and industrial applications, particularly in the synthesis of other organic compounds.
Formula:C9H11Cl2N
InChI:InChI=1S/C9H11Cl2N/c1-9(2,12)8-6(10)4-3-5-7(8)11/h3-5H,12H2,1-2H3
InChI key:InChIKey=DRCMIKCSLJQIFX-UHFFFAOYSA-N
SMILES:C(C)(C)(N)C1=C(Cl)C=CC=C1Cl
Synonyms:- 2-(2,6-Dichlorophenyl)propan-2-amine
- 2,6-Dichloro-α,α-dimethylbenzenemethanamine
- 1-(2,6-Dichloro-phenyl)-1-methyl-ethylamine
- Benzenemethanamine, 2,6-dichloro-α,α-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.