CAS 7471-05-8

2-(4,5-dihydro-1H-imidazol-2-yl)pyridine

Description:

2-(4,5-dihydro-1H-imidazol-2-yl)pyridine, with the CAS number 7471-05-8, is a heterocyclic organic compound characterized by the presence of both a pyridine and an imidazole ring in its structure. This compound typically exhibits properties such as being a colorless to pale yellow solid, with a moderate solubility in polar solvents like water and alcohols, while being less soluble in non-polar solvents. It is known for its potential biological activity, which may include antimicrobial and antifungal properties, making it of interest in pharmaceutical research. The presence of nitrogen atoms in both the imidazole and pyridine rings contributes to its basicity and ability to form coordination complexes with metal ions. Additionally, the compound may participate in various chemical reactions, including nucleophilic substitutions and cyclization processes, due to the reactivity of the imidazole moiety. Overall, 2-(4,5-dihydro-1H-imidazol-2-yl)pyridine is a versatile compound with applications in medicinal chemistry and materials science.

Formula: C₈H₉N₃

InChI: InChI=1/C8H9N3/c1-2-4-9-7(3-1)8-10-5-6-11-8/h1-4H,5-6H2,(H,10,11)

SMILES: c1ccnc(c1)C1=NCCN1

2-(4,5-Dihydro-1H-imidazol-2-yl)pyridine

CAS: 7471-05-8

Formula: C₈H₉N₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 147.1772

Ref: IN-DA00FFCB

2-(4,5-Dihydro-1H-imidazol-2-yl)pyridine

CAS: 7471-05-8

2-(4,5-Dihydro-1H-imidazol-2-yl)pyridine

Purity: 97%

Ref: 54-OR1041828

2-(4,5-Dihydro-1H-imidazol-2-yl)pyridine

CAS: 7471-05-8

Formula: C₈H₉N₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 147.181

Ref: 10-F234063

2-(4,5-Dihydro-1h-imidazol-2-yl)pyridine

Controlled Product

CAS: 7471-05-8

Applications 2-(4,5-dihydro-1H-imidazol-2-yl)pyridine (cas# 7471-05-8) is a useful research chemical.

Formula: C₈H₉N₃

Color and Shape: Neat

Molecular weight: 147.18

Ref: TR-D177851