CAS 7471-10-5
:1H-naphtho[2,3-d]imidazol-2-ylmethanol
Description:
1H-naphtho[2,3-d]imidazol-2-ylmethanol is a chemical compound characterized by its unique structure, which consists of a naphthalene ring fused with an imidazole moiety. This compound features a hydroxymethyl group (-CH2OH) attached to the imidazole nitrogen, contributing to its potential reactivity and solubility in polar solvents. It typically exhibits properties associated with both aromatic compounds and heterocycles, such as stability and the ability to participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding. The presence of the hydroxymethyl group can also influence its biological activity, making it of interest in medicinal chemistry. Additionally, this compound may exhibit fluorescence properties due to its aromatic structure, which can be useful in various applications, including sensors and imaging. Its CAS number, 7471-10-5, allows for easy identification in chemical databases and literature. Overall, 1H-naphtho[2,3-d]imidazol-2-ylmethanol is a versatile compound with potential applications in pharmaceuticals and materials science.
Formula:C12H10N2O
InChI:InChI=1/C12H10N2O/c15-7-12-13-10-5-8-3-1-2-4-9(8)6-11(10)14-12/h1-6,15H,7H2,(H,13,14)
SMILES:c1ccc2cc3c(cc2c1)nc(CO)[nH]3
Synonyms:- 1H-Naphth[2,3-d]imidazole-2-methanol
- 1H-Naphtho[2,3-d]imidazol-2-ylmethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.