CAS 7471-33-2

2-(4-isopropylbenzoyl)benzoic acid

Description:

2-(4-Isopropylbenzoyl)benzoic acid, also known by its CAS number 7471-33-2, is an organic compound characterized by its aromatic structure and functional groups. It features a benzoic acid moiety with an isopropyl-substituted phenyl group at the 2-position. This compound typically exhibits properties such as being a solid at room temperature, with moderate solubility in organic solvents and limited solubility in water due to its hydrophobic aromatic components. It is known for its potential applications in the field of photochemistry and as a UV filter in various formulations, owing to its ability to absorb ultraviolet light. The presence of both carboxylic acid and aromatic groups contributes to its reactivity, making it suitable for various chemical reactions, including esterification and acylation. Additionally, its structural characteristics may influence its melting point, boiling point, and stability under different conditions, which are important for its practical applications in industrial and research settings.

Formula: C₁₇H₁₆O₃

InChI: InChI=1/C17H16O3/c1-11(2)12-7-9-13(10-8-12)16(18)14-5-3-4-6-15(14)17(19)20/h3-11H,1-2H3,(H,19,20)

SMILES: CC(C)c1ccc(cc1)C(=O)c1ccccc1C(=O)O

Synonyms:

• 2-[4-(Propan-2-Yl)Benzoyl]Benzoic Acid