CymitQuimica logo

CAS 7471-52-5

:

5-(2-bromoethyl)imidazolidine-2,4-dione

Description:
5-(2-Bromoethyl)imidazolidine-2,4-dione, with the CAS number 7471-52-5, is a chemical compound that belongs to the class of imidazolidine derivatives. This substance features a five-membered ring structure containing two carbonyl groups, which contribute to its reactivity and potential applications in organic synthesis. The presence of the bromoethyl group enhances its electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. Typically, this compound is a solid at room temperature and may exhibit moderate solubility in polar solvents. Its unique structure allows for potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as well as in agrochemical formulations. Safety data indicates that, like many brominated compounds, it should be handled with care due to potential toxicity and environmental concerns. Proper storage and handling protocols are essential to mitigate risks associated with exposure. Overall, 5-(2-bromoethyl)imidazolidine-2,4-dione is a versatile compound with significant implications in chemical research and industry.
Formula:C5H7BrN2O2
InChI:InChI=1/C5H7BrN2O2/c6-2-1-3-4(9)8-5(10)7-3/h3H,1-2H2,(H2,7,8,9,10)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.