CAS 7471-58-1
:quinazolin-2(1H)-one
Description:
Quinazolin-2(1H)-one is a heterocyclic organic compound characterized by a fused bicyclic structure containing a quinazoline ring with a carbonyl group at the 2-position. It typically appears as a white to off-white crystalline solid and is known for its aromatic properties. The compound is soluble in organic solvents such as ethanol and dimethyl sulfoxide, but has limited solubility in water. Quinazolin-2(1H)-one exhibits various biological activities, making it of interest in medicinal chemistry, particularly for its potential as an anti-cancer and anti-inflammatory agent. Its structure allows for various substitutions, which can enhance its pharmacological properties. The compound's reactivity is influenced by the presence of the nitrogen atoms in the ring, which can participate in hydrogen bonding and coordination with metal ions. Overall, quinazolin-2(1H)-one serves as a valuable scaffold in drug discovery and development, with ongoing research exploring its therapeutic applications.
Formula:C8H6N2O
InChI:InChI=1/C8H6N2O/c11-8-9-5-6-3-1-2-4-7(6)10-8/h1-5H,(H,9,10,11)
SMILES:c1ccc2c(c1)cnc(n2)O
Synonyms:- 2-Quinazolinol
- Quinazolin-2-ol
- 2(1H)-Quinazolinone
- Quinazolin-2(1H)-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Quinazolin-2-ol
CAS:Quinazolin-2-olFormula:C8H6N2OPurity:98%Color and Shape: yellow solidMolecular weight:146.15g/molQuinazolin-2-ol
CAS:Quinazolin-2-ol is a quinazolone compound that inhibits the growth of bacteria, fungi and viruses. It is an antimicrobial agent used to treat bacterial and fungal infections and has been shown to be effective against methicillin resistant Staphylococcus aureus. Quinazolin-2-ol also exhibits significant cytotoxicity and in vitro antifungal activity against Candida albicans. This compound is absorbed into human serum and can inhibit copper-dependent enzymes such as anthranilate synthase. Quinazolin-2-ol also has immunosuppressive properties, which may be due to its ability to inhibit the production of cytokines such as IL-1β, IL-6, TNFα, or IL-10.Formula:C8H6N2OPurity:Min. 95%Color and Shape:PowderMolecular weight:146.15 g/mol


