CAS 7471-95-6

9H-fluorene-9-carboxamide

Description:

9H-Fluorene-9-carboxamide, with the CAS number 7471-95-6, is an organic compound characterized by its structure, which consists of a fluorene backbone with a carboxamide functional group. This compound typically appears as a white to off-white solid and is known for its relatively stable nature under standard conditions. It is soluble in organic solvents such as dichloromethane and dimethyl sulfoxide, but has limited solubility in water. The presence of the carboxamide group imparts polar characteristics, influencing its reactivity and interactions with other molecules. 9H-Fluorene-9-carboxamide is often utilized in organic synthesis and materials science, particularly in the development of fluorescent dyes and as a building block in the synthesis of more complex organic compounds. Its unique properties make it a subject of interest in various fields, including medicinal chemistry and polymer science. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₁₄H₁₁NO

InChI: InChI=1/C14H11NO/c15-14(16)13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1-8,13H,(H2,15,16)

SMILES: c1ccc2c(c1)c1ccccc1C2C(=N)O

Synonyms:

• 9H-Fluorene-9-Carboxylic Acid Amide

Fluorene-9-carboxamide

Controlled Product

CAS: 7471-95-6

Formula: C₁₄H₁₁NO

Color and Shape: Neat

Molecular weight: 209.243

Ref: TR-F462010