CAS 74712-19-9
:Bromobutide
Description:
Bromobutide, identified by the CAS number 74712-19-9, is a chemical compound that belongs to the class of organic bromides. It typically features a butyl group bonded to a bromine atom, which contributes to its reactivity and potential applications in organic synthesis. The presence of the bromine atom makes it a good candidate for nucleophilic substitution reactions, allowing for the introduction of various functional groups. Bromobutide is generally characterized by its moderate volatility and solubility in organic solvents, which is common for many brominated compounds. Its physical properties, such as boiling point and melting point, can vary based on the specific isomer or structural form. In terms of safety, like many brominated compounds, it may pose health risks if inhaled or ingested, necessitating proper handling and storage procedures. Overall, Bromobutide serves as a useful intermediate in the synthesis of pharmaceuticals and agrochemicals, highlighting its significance in chemical research and industry.
Formula:C15H22BrNO
InChI:InChI=1S/C15H22BrNO/c1-14(2,3)12(16)13(18)17-15(4,5)11-9-7-6-8-10-11/h6-10,12H,1-5H3,(H,17,18)
InChI key:InChIKey=WZDDLAZXUYIVMU-UHFFFAOYSA-N
SMILES:C(NC(C(C(C)(C)C)Br)=O)(C)(C)C1=CC=CC=C1
Synonyms:- 2-Brom-3,3-dimethyl-N-(2-phenyl-2-propanyl)butanamid
- 2-Brom-3,3-dimethyl-N-(2-phenylpropan-2-yl)butanamid
- 2-Bromo-3,3-dimethyl-N-(1-methyl-1-phenylethyl)butanamide
- 2-Bromo-3,3-dimethyl-N-(2-phenyl-2-propanyl)butanamide
- 2-Bromo-3,3-dimethyl-N-(α,α-dimethylbenzyl)butyramide
- 2-Bromo-3,3-dimethyl-N-N-(a,a-dimethylbenzyl)butyramide
- 2-Bromo-N-(α,α-dimethylbenzyl)-3,3-dimethylbutanamide
- 74712-19-9
- Bromobutide
- Butanamide, 2-bromo-3,3-dimethyl-N-(1-methyl-1-phenylethyl)-
- S 4347
- S 47 (pesticide)
- Sumiherb
- 2-Bromo-3,3-dimethyl-N-(2-phenylpropan-2-yl)butanamide
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 5 products.
Bromobutide 100 µg/mL in Methanol
CAS:Controlled ProductFormula:C15H22BrNOColor and Shape:Single SolutionMolecular weight:312.25Bromobutide
CAS:Bromobutide is an acetanilide herbicide.
Formula:C15H22BrNOColor and Shape:SolidMolecular weight:312.24



