CymitQuimica logo

CAS 7472-15-3

:

4-aminobenzenesulfinic acid

Description:
4-Aminobenzenesulfinic acid, also known as sulfanilic acid, is an aromatic sulfonic acid characterized by the presence of both an amino group (-NH2) and a sulfonic acid group (-SO3H) attached to a benzene ring. This compound typically appears as a white to pale yellow crystalline solid and is soluble in water, which is a notable feature due to the polar nature of the sulfonic acid group. It has a melting point that varies depending on purity and form. 4-Aminobenzenesulfinic acid is commonly used in the synthesis of azo dyes, as it can undergo diazotization to form diazonium salts, which are key intermediates in dye production. Additionally, it serves as a reagent in various chemical reactions, including those in analytical chemistry for detecting nitrites. The compound is also of interest in biological studies due to its potential applications in pharmaceuticals and as a precursor for other chemical syntheses. Safety precautions should be observed when handling this substance, as it may pose health risks if ingested or inhaled.
Formula:C6H7NO2S
InChI:InChI=1/C6H7NO2S/c7-5-1-3-6(4-2-5)10(8)9/h1-4H,7H2,(H,8,9)
SMILES:c1cc(ccc1N)S(=O)O
Synonyms:
  • Benzenesulfinic Acid, 4-Amino-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.