CAS 7472-16-4
:P-(2-Aminophenyl)phosphonic acid
Description:
P-(2-Aminophenyl)phosphonic acid, with the CAS number 7472-16-4, is an organophosphorus compound characterized by the presence of a phosphonic acid group attached to a phenyl ring that has an amino substituent in the para position. This compound typically appears as a white to off-white solid and is soluble in water due to the presence of the phosphonic acid functional group, which can ionize to form phosphonate ions. The amino group can participate in hydrogen bonding and may influence the compound's reactivity and interactions with other molecules. P-(2-Aminophenyl)phosphonic acid is of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development and as a ligand in coordination chemistry. Its unique structure allows for various chemical modifications, making it a versatile building block in synthetic organic chemistry. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C6H8NO3P
InChI:InChI=1S/C6H8NO3P/c7-5-3-1-2-4-6(5)11(8,9)10/h1-4H,7H2,(H2,8,9,10)
InChI key:InChIKey=BMYBKYQDGKGCSU-UHFFFAOYSA-N
SMILES:P(=O)(O)(O)C1=C(N)C=CC=C1
Synonyms:- Phosphonic acid, P-(2-aminophenyl)-
- P-(2-Aminophenyl)phosphonic acid
- o-Aminophenylphosphonic acid
- Phosphonic acid, (2-aminophenyl)-
- Phosphonic acid, (o-aminophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.