CAS 7472-25-5
:1,1-dimethoxybutan-2-ol
Description:
1,1-Dimethoxybutan-2-ol is an organic compound characterized by its structure, which includes a butanol backbone with two methoxy groups attached to the first carbon and a hydroxyl group on the second carbon. This compound is typically a colorless liquid with a moderate boiling point and is soluble in polar solvents due to the presence of the hydroxyl group, which can engage in hydrogen bonding. The methoxy groups contribute to its reactivity and can influence its physical properties, such as volatility and polarity. 1,1-Dimethoxybutan-2-ol may be used in various applications, including as a solvent or intermediate in organic synthesis. Its chemical behavior is influenced by the functional groups present, making it a subject of interest in both industrial and research settings. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure safe usage and compliance with regulations.
Formula:C6H14O3
InChI:InChI=1/C6H14O3/c1-4-5(7)6(8-2)9-3/h5-7H,4H2,1-3H3
SMILES:CCC(C(OC)OC)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,1-Dimethoxy-2-butanol
CAS:Controlled ProductFormula:C6H14O3Color and Shape:NeatMolecular weight:134.17
