CAS 74720-33-5
:(3Z,6Z)-3,6-bis(phenylmethylidene)piperazine-2,5-dione
Description:
The chemical substance known as (3Z,6Z)-3,6-bis(phenylmethylidene)piperazine-2,5-dione, with the CAS number 74720-33-5, is a synthetic compound characterized by its unique piperazine core structure. This compound features two phenylmethylidene groups attached to the piperazine ring, which contributes to its potential biological activity and chemical reactivity. The presence of the dione functional groups indicates that it has two carbonyl (C=O) functionalities, which can participate in various chemical reactions, including nucleophilic additions and condensation reactions. The geometric isomerism (Z configuration) suggests that the compound has specific spatial arrangements that may influence its interactions with biological targets. This compound may exhibit properties such as antimicrobial, antifungal, or anticancer activities, making it of interest in medicinal chemistry. Its solubility, stability, and reactivity can vary based on the solvent and environmental conditions, which are important considerations for its application in research and potential therapeutic uses.
Formula:C18H14N2O2
InChI:InChI=1/C18H14N2O2/c21-17-15(11-13-7-3-1-4-8-13)19-18(22)16(20-17)12-14-9-5-2-6-10-14/h1-12H,(H,19,22)(H,20,21)/b15-11-,16-12-
SMILES:c1ccc(cc1)/C=c\1/c(n/c(=C\c2ccccc2)/c(n1)O)O
Synonyms:- (3Z,6Z)-3,6-dibenzylidenepiperazine-2,5-dione
- 2,5-piperazinedione, 3,6-bis(phenylmethylene)-, (3Z,6Z)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Piperafizine B
CAS:Piperafizine B is a synthetic alkaloid, which is derived from chemical synthesis of analogs related to natural alkaloids. It operates through interaction with specific cellular targets, potentially modulating various biochemical pathways. The exact mode of action is proposed to involve binding to particular receptors or enzymes, leading to alterations in cell signaling processes. Further research is underway to elucidate the precise mechanisms by which these interactions manifest at the molecular level.Formula:C18H14N2O2Purity:Min. 95%Molecular weight:290.3 g/mol
