CAS 7473-12-3
:8-nitroisoquinoline
Description:
8-Nitroisoquinoline is an organic compound characterized by its isoquinoline structure, which is a bicyclic compound consisting of a benzene ring fused to a pyridine ring. The presence of a nitro group (-NO2) at the 8-position of the isoquinoline framework imparts unique chemical properties, including increased reactivity and potential for electrophilic substitution reactions. This compound is typically a yellow to orange crystalline solid and is known for its applications in organic synthesis and as a building block in the development of pharmaceuticals and agrochemicals. It exhibits moderate solubility in organic solvents, and its reactivity can be influenced by the electron-withdrawing nature of the nitro group. Additionally, 8-nitroisoquinoline can participate in various chemical reactions, such as reduction and nucleophilic substitution, making it a valuable intermediate in synthetic organic chemistry. Safety precautions should be taken when handling this compound, as nitro compounds can be hazardous and may pose environmental risks.
Formula:C9H6N2O2
InChI:InChI=1/C9H6N2O2/c12-11(13)9-3-1-2-7-4-5-10-6-8(7)9/h1-6H
SMILES:c1cc2ccncc2c(c1)N(=O)=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
