CAS 7473-36-1
:ethyl B-D-thioglucoside
Description:
Ethyl B-D-thioglucoside is a chemical compound characterized by its structure, which includes a thiol group (-SH) attached to a glucoside moiety. This compound is typically used in biochemical applications, particularly in the synthesis of glycosides and as a substrate in enzymatic reactions. Ethyl B-D-thioglucoside is known for its ability to participate in glycosylation reactions, where it can act as a donor of sugar moieties. It is soluble in water and organic solvents, making it versatile for various laboratory applications. The presence of the thiol group also imparts unique reactivity, allowing it to form disulfide bonds or participate in redox reactions. Additionally, this compound is often utilized in studies involving carbohydrate chemistry and can serve as a protective group in organic synthesis. Safety precautions should be taken when handling this substance, as it may pose health risks if ingested or inhaled. Overall, ethyl B-D-thioglucoside is a valuable reagent in chemical and biochemical research.
Formula:C8H16O5S
InChI:InChI=1/C8H16O5S/c1-2-14-8-7(12)6(11)5(10)4(3-9)13-8/h4-12H,2-3H2,1H3
SMILES:CCSC1C(C(C(C(CO)O1)O)O)O
Synonyms:- Ethyl 1-Thiohexopyranoside
- Ethyl Beta-D-Thioglucoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Ethyl 1-Thio-β-D-Glucopyranoside
CAS:Ethyl 1-Thio-β-D-GlucopyranosidePurity:98%Molecular weight:224.27g/molEthyl β-D-thioglucopyranoside
CAS:Ethyl β-D-thioglucopyranoside is a custom synthesis that has been modified with fluorination and methylation, which has made it a monosaccharide. This product is synthetic and can be used for click modification. It is also an oligosaccharide, saccharide, and polysaccharide. Ethyl β-D-thioglucopyranoside is a sugar that belongs to the complex carbohydrate group. It is highly pure and has no impurities.Formula:C8H16O5SPurity:Min. 95%Color and Shape:White PowderMolecular weight:224.28 g/mol(2S,3R,4S,5S,6R)-2-(Ethylthio)-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol
CAS:Formula:C8H16O5SPurity:95.0%Molecular weight:224.27Ethyl β-Thioglucopyranoside
CAS:Controlled ProductFormula:C8H16O5SColor and Shape:NeatMolecular weight:224.27






