CAS 7473-42-9
:methyl-2,3,5-tri-O-benzoyl-A-D-*arabinofuranoside
Description:
Methyl-2,3,5-tri-O-benzoyl-α-D-arabinofuranoside is a glycoside derivative of arabinose, characterized by the presence of three benzoyl groups attached to the hydroxyl positions of the sugar moiety. This compound is typically used in organic synthesis and carbohydrate chemistry, particularly in the study of glycosylation reactions and the synthesis of more complex carbohydrates. The benzoyl groups serve as protecting groups, which help to stabilize the molecule and facilitate further chemical transformations. The methyl group at the anomeric position enhances the solubility of the compound in organic solvents and can influence its reactivity. Methyl-2,3,5-tri-O-benzoyl-α-D-arabinofuranoside is generally a white to off-white crystalline solid, and its properties include moderate solubility in organic solvents like dichloromethane and ethyl acetate. The compound's structure allows for various applications in synthetic organic chemistry, particularly in the synthesis of oligosaccharides and other carbohydrate derivatives.
Formula:C27H24O8
InChI:InChI=1/C27H24O8/c1-31-27-23(35-26(30)20-15-9-4-10-16-20)22(34-25(29)19-13-7-3-8-14-19)21(33-27)17-32-24(28)18-11-5-2-6-12-18/h2-16,21-23,27H,17H2,1H3
SMILES:COC1C(C(C(COC(=O)c2ccccc2)O1)OC(=O)c1ccccc1)OC(=O)c1ccccc1
Synonyms:- methyl 2,3,5-tri-O-benzoylpentofuranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Methyl-2,3,5-tri-O-benzoyl-α-D-arabinofuranoside
CAS:Formula:C27H24O8Purity:98%Color and Shape:SolidMolecular weight:476.4747(2R,3R,4S,5S)-2-((Benzoyloxy)Methyl)-5-Methoxytetrahydrofuran-3,4-Diyl Dibenzoate
CAS:(2R,3R,4S,5S)-2-((Benzoyloxy)Methyl)-5-Methoxytetrahydrofuran-3,4-Diyl DibenzoatePurity:98%Molecular weight:476.47g/molMethyl 2,3,5-tri-O-benzoyl-α-D-arabinofuranoside
CAS:<p>Methyl 2,3,5-tri-O-benzoyl-α-D-arabinofuranoside is an antiperspirant that prevents the formation of sweat. It is a mixture of two active ingredients: methyl 2,3,5-tri-O-benzoyl-α-D-arabinofuranoside and zinc oxide. The former inhibits the formation of sweat by binding to the protein in eccrine glands and preventing it from absorbing chloride ions. Zinc oxide reduces body odor by binding to sulfur compounds that are secreted by bacteria on skin surfaces. Methyl 2,3,5-triO-benzoyl arabinofuranoside and zinc oxide are used as a combination for their complementary effects.</p>Formula:C27H24O8Purity:Min. 95%Color and Shape:PowderMolecular weight:476.47 g/mol
