CymitQuimica logo

CAS 7473-67-8

:

9-bromophenanthren-3-amine

Description:
9-Bromophenanthren-3-amine is an organic compound characterized by its structure, which includes a phenanthrene backbone substituted with a bromine atom at the 9-position and an amino group at the 3-position. This compound is part of the polycyclic aromatic amine family, which often exhibits interesting chemical properties due to the presence of both aromatic rings and functional groups. The bromine substitution can influence the compound's reactivity, making it useful in various chemical reactions, including electrophilic substitutions and coupling reactions. The amino group can participate in hydrogen bonding and may enhance the compound's solubility in polar solvents. Additionally, compounds like 9-bromophenanthren-3-amine may have applications in organic synthesis, materials science, and potentially in medicinal chemistry, although specific biological activities would require further investigation. Safety considerations should be taken into account, as brominated compounds can pose environmental and health risks. Overall, 9-bromophenanthren-3-amine is a notable compound for its structural features and potential applications in various fields of chemistry.
Formula:C14H10BrN
InChI:InChI=1/C14H10BrN/c15-14-7-9-5-6-10(16)8-13(9)11-3-1-2-4-12(11)14/h1-8H,16H2
SMILES:c1ccc2c(c1)c1cc(ccc1cc2Br)N
Synonyms:
  • 3-Phenanthrenamine, 9-Bromo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.