CAS 7473-88-3
:2-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)-N-(4-methylphenyl)acetamide
Description:
The chemical substance known as 2-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)-N-(4-methylphenyl)acetamide, with the CAS number 7473-88-3, is a compound that features a complex structure characterized by an isoindole core. This compound typically exhibits properties associated with amides, including potential solubility in polar solvents and the ability to participate in hydrogen bonding due to the presence of the amide functional group. The presence of the dioxo group suggests that it may exhibit reactivity typical of carbonyl compounds, such as nucleophilic addition or condensation reactions. Additionally, the methylphenyl substituent can influence the compound's lipophilicity and biological activity. Such compounds may be of interest in medicinal chemistry for their potential pharmacological properties, including anti-inflammatory or analgesic effects. However, specific characteristics such as melting point, boiling point, and spectral data would require empirical determination or literature reference for precise values. Overall, this compound represents a class of organic molecules that may have diverse applications in chemical synthesis and drug development.
Formula:C17H14N2O3
InChI:InChI=1/C17H14N2O3/c1-11-6-8-12(9-7-11)18-15(20)10-19-16(21)13-4-2-3-5-14(13)17(19)22/h2-9H,10H2,1H3,(H,18,20)
Synonyms:- 2H-isoindole-2-acetamide, 1,3-dihydro-N-(4-methylphenyl)-1,3-dioxo-
- 2-(1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)-N-(4-methylphenyl)acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.