CAS 747397-27-9
:(2S)-2-amino-3-(4-bromophenyl)-2-methyl-propanoic acid
Description:
(2S)-2-amino-3-(4-bromophenyl)-2-methyl-propanoic acid, also known as a brominated amino acid, is characterized by its chiral center at the second carbon, which contributes to its specific stereochemistry. This compound features an amino group (-NH2), a carboxylic acid group (-COOH), and a side chain that includes a 4-bromophenyl group, which enhances its hydrophobic characteristics and may influence its biological activity. The presence of the bromine atom introduces additional reactivity and can affect the compound's interactions with biological targets. This amino acid derivative is likely to be soluble in polar solvents due to the carboxylic acid group, while the aromatic bromophenyl moiety may provide some lipophilicity. Its structural features suggest potential applications in pharmaceuticals, particularly in the development of drugs targeting specific receptors or enzymes. The compound's unique properties make it a subject of interest in medicinal chemistry and biochemistry, where it may serve as a building block for more complex molecules or as a tool for studying protein interactions.
Formula:C10H12BrNO2
InChI:InChI=1/C10H12BrNO2/c1-10(12,9(13)14)6-7-2-4-8(11)5-3-7/h2-5H,6,12H2,1H3,(H,13,14)/t10-/m0/s1
SMILES:C[C@](Cc1ccc(cc1)Br)(C(=O)O)N
Synonyms:- 4-bromo-a-methyl-L-phenylalanine
- 747397-27-9
- L-phenylalanine, 4-bromo-a-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.