CAS 747405-49-8

(2R)-2-amino-3-(2,3,4,5-tetrafluorophenyl)propanoic acid

Description:

(2R)-2-amino-3-(2,3,4,5-tetrafluorophenyl)propanoic acid, with CAS number 747405-49-8, is an amino acid derivative characterized by the presence of a chiral center at the second carbon atom, which contributes to its stereochemistry. This compound features a propanoic acid backbone, with an amino group (-NH2) and a tetrafluorophenyl group attached to the third carbon. The tetrafluorophenyl moiety significantly influences the compound's electronic properties and hydrophobicity due to the presence of multiple fluorine atoms, which can enhance its biological activity and interaction with proteins or enzymes. The compound is likely to exhibit polar characteristics due to the carboxylic acid and amino functional groups, making it soluble in polar solvents. Its unique structure may render it useful in pharmaceutical applications, particularly in the development of drugs targeting specific biological pathways. Additionally, the presence of fluorine atoms can improve metabolic stability and bioavailability, making it a subject of interest in medicinal chemistry.

Formula: C₉H₇F₄NO₂

InChI: InChI=1/C9H7F4NO2/c10-4-1-3(2-5(14)9(15)16)6(11)8(13)7(4)12/h1,5H,2,14H2,(H,15,16)/t5-/m1/s1

SMILES: c1c(C[C@H](C(=O)O)N)c(c(c(c1F)F)F)F