CAS 747411-16-1

2-Chloro-N-[2-[[4-chloro-2-(trifluoromethyl)phenyl]amino]-2-oxoethyl]-N-(1-methylethyl)acetamide

Description:

2-Chloro-N-[2-[[4-chloro-2-(trifluoromethyl)phenyl]amino]-2-oxoethyl]-N-(1-methylethyl)acetamide, with CAS number 747411-16-1, is a synthetic organic compound characterized by its complex structure, which includes a chloro group, a trifluoromethyl group, and an acetamide moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many halogenated organic compounds. Its molecular structure suggests potential biological activity, making it of interest in pharmaceutical research, particularly in the development of therapeutic agents. The presence of multiple functional groups may contribute to its reactivity and interaction with biological targets. Additionally, the compound's stability under standard laboratory conditions is generally expected, although specific handling and storage conditions should be observed to maintain its integrity. As with many chemical substances, safety data sheets should be consulted for information on toxicity, handling precautions, and environmental impact.

Formula: C₁₄H₁₅Cl₂F₃N₂O₂

InChI: InChI=1S/C14H15Cl2F3N2O2/c1-8(2)21(13(23)6-15)7-12(22)20-11-4-3-9(16)5-10(11)14(17,18)19/h3-5,8H,6-7H2,1-2H3,(H,20,22)

InChI key: InChIKey=NCFQQSCEJZFFBI-UHFFFAOYSA-N

SMILES: N(C(CN(C(CCl)=O)C(C)C)=O)C1=C(C(F)(F)F)C=C(Cl)C=C1

Synonyms:

• 2-Chloro-N-[2-[[4-chloro-2-(trifluoromethyl)phenyl]amino]-2-oxoethyl]-N-(1-methylethyl)acetamide
• 2-Chloro-N-([[4-chloro-2-(trifluoromethyl)phenyl]carbamoyl]methyl)-N-(propan-2-yl)acetamide
• Acetamide, 2-chloro-N-[2-[[4-chloro-2-(trifluoromethyl)phenyl]amino]-2-oxoethyl]-N-(1-methylethyl)-