CAS 747411-55-8

5-Chloro-2-(4-methyl-1-piperazinyl)benzenamine

Description:

5-Chloro-2-(4-methyl-1-piperazinyl)benzenamine, with the CAS number 747411-55-8, is an organic compound characterized by its aromatic amine structure. It features a chloro substituent at the 5-position and a piperazine ring with a methyl group at the 4-position attached to a benzene ring. This compound is typically a solid at room temperature and is soluble in polar organic solvents. Its molecular structure suggests potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the piperazine moiety often indicates potential interactions with biological targets, such as receptors or enzymes. Additionally, the chlorine atom may influence the compound's reactivity and lipophilicity, affecting its pharmacokinetic properties. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, due to potential toxicity or environmental impact. Overall, 5-Chloro-2-(4-methyl-1-piperazinyl)benzenamine is a compound of interest for further research and application in various chemical and pharmaceutical contexts.

Formula: C₁₁H₁₆ClN₃

InChI: InChI=1S/C11H16ClN3/c1-14-4-6-15(7-5-14)11-3-2-9(12)8-10(11)13/h2-3,8H,4-7,13H2,1H3

InChI key: InChIKey=YCISPNUGBJCZPW-UHFFFAOYSA-N

SMILES: NC1=C(N2CCN(C)CC2)C=CC(Cl)=C1

Synonyms:

• 5-Chloro-2-(4-methyl-1-piperazinyl)benzenamine
• Benzenamine, 5-chloro-2-(4-methyl-1-piperazinyl)-

5-Chloro-2-(4-methyl-piperazin-1-yl)-phenylamine

CAS: 747411-55-8

Versatile small molecule scaffold

Formula: C₁₁H₁₆ClN₃

Purity: Min. 95%

Molecular weight: 225.72 g/mol

Ref: 3D-XEB41155