CAS 747413-17-8

1-(3-Bromophenyl)-4-methylpiperazine

Description:

1-(3-Bromophenyl)-4-methylpiperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of a bromophenyl group at the 1-position and a methyl group at the 4-position contributes to its unique properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic aromatic component. It is often studied for its potential biological activity, particularly in the fields of medicinal chemistry and pharmacology, where piperazine derivatives are known to exhibit various pharmacological effects. The bromine substituent can influence the compound's reactivity and interaction with biological targets, making it of interest in drug design. Additionally, the compound's molecular structure allows for potential interactions with neurotransmitter systems, which may be relevant in the development of therapeutic agents. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and environmental impact.

Formula: C₁₁H₁₅BrN₂

InChI: InChI=1S/C11H15BrN2/c1-13-5-7-14(8-6-13)11-4-2-3-10(12)9-11/h2-4,9H,5-8H2,1H3

InChI key: InChIKey=HJRZEXYEOXVFGH-UHFFFAOYSA-N

SMILES: BrC=1C=C(C=CC1)N2CCN(C)CC2

Synonyms:

• 1-(3-Bromophenyl)-4-methylpiperazine
• Piperazine, 1-(3-bromophenyl)-4-methyl-

1-(3-Bromophenyl)-4-methylpiperazine

Controlled Product

CAS: 747413-17-8

Versatile small molecule scaffold

Formula: C₁₁H₁₅BrN₂

Purity: Min. 95%

Molecular weight: 255.15 g/mol

Ref: 3D-XEB41317