CAS 747413-22-5

Boronic acid, [4-[[[2-(methylsulfonyl)ethyl]amino]methyl]phenyl]-

Description:

Boronic acids are a class of organic compounds characterized by the presence of a boron atom bonded to a hydroxyl group and an organic substituent. The specific compound you mentioned, with the name "Boronic acid, [4-[[[2-(methylsulfonyl)ethyl]amino]methyl]phenyl]-" and CAS number 747413-22-5, features a boronic acid functional group attached to a phenyl ring that is further substituted with an aminoethyl group and a methylsulfonyl group. This structure suggests that the compound may exhibit properties such as moderate solubility in polar solvents, potential reactivity in cross-coupling reactions, and the ability to form complexes with diols, which is a characteristic behavior of boronic acids. Additionally, the presence of the methylsulfonyl group may enhance its solubility and influence its biological activity, making it of interest in medicinal chemistry and material science. Overall, this compound's unique structure may confer specific reactivity and functional properties suitable for various applications in organic synthesis and pharmaceuticals.

Formula: C₁₀H₁₆BNO₄S

InChI: InChI=1S/C10H16BNO4S/c1-17(15,16)7-6-12-8-9-2-4-10(5-3-9)11(13)14/h2-5,12-14H,6-8H2,1H3

InChI key: InChIKey=SSIJYBSHDJHSOG-UHFFFAOYSA-N

SMILES: B(O)(O)C1=CC=C(CNCCS(C)(=O)=O)C=C1

Synonyms:

• Boronic acid, [4-[[[2-(methylsulfonyl)ethyl]amino]methyl]phenyl]-

Boronic acid, [4-[[[2-(methylsulfonyl)ethyl]amino]methyl]phenyl]-

CAS: 747413-22-5

Formula: C₁₀H₁₆BNO₄S

Molecular weight: 257.1143

Ref: IN-DA01RD2D