CAS 74746-06-8

2,6-Dibromo-4-methoxybenzonitrile

Description:

2,6-Dibromo-4-methoxybenzonitrile is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two bromine atoms and a methoxy group, as well as a cyano group. The presence of the bromine atoms enhances its reactivity and can influence its physical properties, such as solubility and boiling point. The methoxy group (-OCH3) is an electron-donating substituent that can affect the compound's electronic properties and reactivity in electrophilic aromatic substitution reactions. The cyano group (-CN) is a strong electron-withdrawing group, which can significantly impact the compound's acidity and nucleophilicity. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its physical properties, such as melting point and solubility, can vary based on the specific conditions and solvents used. Safety precautions should be taken when handling this compound, as it may pose health risks due to the presence of bromine and the cyano group.

Formula: C₈H₅Br₂NO

InChI: InChI=1S/C8H5Br2NO/c1-12-5-2-7(9)6(4-11)8(10)3-5/h2-3H,1H3

InChI key: InChIKey=BLUBNYRIUYVWOA-UHFFFAOYSA-N

SMILES: C(#N)C1=C(Br)C=C(OC)C=C1Br

Synonyms:

• Benzonitrile, 2,6-dibromo-4-methoxy-
• 3,5-Dibromo-4-cyanoanisole
• 2,6-Dibromo-4-methoxybenzonitrile