CAS 7475-05-0
:N,N-dimethylnaphthalene-1,4-diamine
Description:
N,N-Dimethylnaphthalene-1,4-diamine, with the CAS number 7475-05-0, is an organic compound characterized by its structure, which features a naphthalene backbone substituted with two methyl groups and two amino groups at the 1 and 4 positions. This compound typically appears as a solid at room temperature and is known for its aromatic properties due to the naphthalene moiety. It is soluble in organic solvents and exhibits moderate stability under standard conditions. The presence of amino groups makes it a potential candidate for various chemical reactions, including coupling reactions and as a building block in the synthesis of dyes, pigments, and polymers. Additionally, N,N-dimethylnaphthalene-1,4-diamine may exhibit biological activity, which could be of interest in pharmaceutical research. However, like many amines, it may also pose health risks, necessitating proper handling and safety precautions during use. Overall, its unique structure and reactivity make it a valuable compound in organic synthesis and materials science.
Formula:C12H14N2
InChI:InChI=1/C12H14N2/c1-14(2)12-8-7-11(13)9-5-3-4-6-10(9)12/h3-8H,13H2,1-2H3
SMILES:CN(C)c1ccc(c2ccccc12)N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N1,N1-Dimethyl-1,4-naphthalenediamine Hydrochloride
CAS:Controlled ProductApplications Intermediate in the synthesis of a naphtalene analog of 4-(4'-N,N-Dimethylaminophenyl)urazole (D451750).
Formula:C12H15ClN2Color and Shape:NeatMolecular weight:222.71
